C16H15F2NO3 — CID 119121716
3-[(2,5-difluorophenyl)methylcarbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid (PubChem CID 119121716) has the molecular formula C16H15F2NO3 and a molecular weight of 307.30 g/mol. Its IUPAC name is 3-[(2,5-difluorophenyl)methylcarbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid.
| Compound Name | 3-[(2,5-difluorophenyl)methylcarbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 119121716 |
| Molecular Formula | C16H15F2NO3 |
| Molecular Weight | 307.30 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | 3-[(2,5-difluorophenyl)methylcarbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| SMILES | O=C(O)C1C2C=CC(C2)C1C(=O)NCc1cc(F)ccc1F |
| InChI | InChI=1S/C16H15F2NO3/c17-11-3-4-12(18)10(6-11)7-19-15(20)13-8-1-2-9(5-8)14(13)16(21)22/h1-4,6,8-9,13-14H,5,7H2,(H,19,20)(H,21,22) |
| InChIKey | COKXQQKFUIAUKA-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.30 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|