About 2-[(3R,4S)-1-(cyclopropanecarbonyl)-3-ethylpiperidin-4-yl]-N-cyclopropylacetamide
2-[(3R,4S)-1-(cyclopropanecarbonyl)-3-ethylpiperidin-4-yl]-N-cyclopropylacetamide (PubChem CID 11912219) has the molecular formula C16H26N2O2
and a molecular weight of 278.40 g/mol. Its IUPAC name is 2-[(3R,4S)-1-(cyclopropanecarbonyl)-3-ethylpiperidin-4-yl]-N-cyclopropylacetamide.
Molecular Properties
| Compound Name | 2-[(3R,4S)-1-(cyclopropanecarbonyl)-3-ethylpiperidin-4-yl]-N-cyclopropylacetamide |
| PubChem CID | 11912219 |
| Molecular Formula | C16H26N2O2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | 2-[(3R,4S)-1-(cyclopropanecarbonyl)-3-ethylpiperidin-4-yl]-N-cyclopropylacetamide |
| SMILES | CC[C@H]1CN(C(=O)C2CC2)CC[C@H]1CC(=O)NC1CC1 |
| InChI | InChI=1S/C16H26N2O2/c1-2-11-10-18(16(20)12-3-4-12)8-7-13(11)9-15(19)17-14-5-6-14/h11-14H,2-10H2,1H3,(H,17,19)/t11-,13-/m0/s1 |
| InChIKey | XVMUWCILZTWHCE-AAEUAGOBSA-N |
| XLogP | 1.94 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(3R,4S)-1-(cyclopropanecarbonyl)-3-ethylpiperidin-4-yl]-N-cyclopropylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3R,4S)-1-(cyclopropanecarbonyl)-3-ethylpiperidin-4-yl]-N-cyclopropylacetamide?
The IUPAC name of 2-[(3R,4S)-1-(cyclopropanecarbonyl)-3-ethylpiperidin-4-yl]-N-cyclopropylacetamide (CID 11912219) is 2-[(3R,4S)-1-(cyclopropanecarbonyl)-3-ethylpiperidin-4-yl]-N-cyclopropylacetamide.
What is the SMILES notation for 2-[(3R,4S)-1-(cyclopropanecarbonyl)-3-ethylpiperidin-4-yl]-N-cyclopropylacetamide?
The canonical SMILES for 2-[(3R,4S)-1-(cyclopropanecarbonyl)-3-ethylpiperidin-4-yl]-N-cyclopropylacetamide is CC[C@H]1CN(C(=O)C2CC2)CC[C@H]1CC(=O)NC1CC1.
What is the InChIKey of 2-[(3R,4S)-1-(cyclopropanecarbonyl)-3-ethylpiperidin-4-yl]-N-cyclopropylacetamide?
The InChIKey is XVMUWCILZTWHCE-AAEUAGOBSA-N. The full InChI is InChI=1S/C16H26N2O2/c1-2-11-10-18(16(20)12-3-4-12)8-7-13(11)9-15(19)17-14-5-6-14/h11-14H,2-10H2,1H3,(H,17,19)/t11-,13-/m0/s1.
What are the key properties of 2-[(3R,4S)-1-(cyclopropanecarbonyl)-3-ethylpiperidin-4-yl]-N-cyclopropylacetamide?
2-[(3R,4S)-1-(cyclopropanecarbonyl)-3-ethylpiperidin-4-yl]-N-cyclopropylacetamide has a molecular weight of 278.40 g/mol, XLogP of 1.94, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3R,4S)-1-(cyclopropanecarbonyl)-3-ethylpiperidin-4-yl]-N-cyclopropylacetamide is sourced from PubChem (CID 11912219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).