C15H22N2O2S — CID 119123191
(Z)-N-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-2-methyl-3-phenylprop-2-en-1-amine (PubChem CID 119123191) has the molecular formula C15H22N2O2S and a molecular weight of 294.42 g/mol. Its IUPAC name is (Z)-N-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-2-methyl-3-phenylprop-2-en-1-amine.
| Compound Name | (Z)-N-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-2-methyl-3-phenylprop-2-en-1-amine |
|---|---|
| PubChem CID | 119123191 |
| Molecular Formula | C15H22N2O2S |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | (Z)-N-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-2-methyl-3-phenylprop-2-en-1-amine |
| SMILES | C/C(=C/c1ccccc1)CNCCN1CCCS1(=O)=O |
| InChI | InChI=1S/C15H22N2O2S/c1-14(12-15-6-3-2-4-7-15)13-16-8-10-17-9-5-11-20(17,18)19/h2-4,6-7,12,16H,5,8-11,13H2,1H3/b14-12- |
| InChIKey | HREGKKKQBNWUPJ-OWBHPGMISA-N |
| XLogP | 1.72 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|