C22H24N6O — CID 119123580
2-[4-(3-ethyl-1,2,4-oxadiazol-5-yl)phenyl]-N-[(1-methyl-3-pyridin-4-ylpyrazol-4-yl)methyl]ethanamine (PubChem CID 119123580) has the molecular formula C22H24N6O and a molecular weight of 388.48 g/mol. Its IUPAC name is 2-[4-(3-ethyl-1,2,4-oxadiazol-5-yl)phenyl]-N-[(1-methyl-3-pyridin-4-ylpyrazol-4-yl)methyl]ethanamine.
| Compound Name | 2-[4-(3-ethyl-1,2,4-oxadiazol-5-yl)phenyl]-N-[(1-methyl-3-pyridin-4-ylpyrazol-4-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 119123580 |
| Molecular Formula | C22H24N6O |
| Molecular Weight | 388.48 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | 2-[4-(3-ethyl-1,2,4-oxadiazol-5-yl)phenyl]-N-[(1-methyl-3-pyridin-4-ylpyrazol-4-yl)methyl]ethanamine |
| SMILES | CCc1noc(-c2ccc(CCNCc3cn(C)nc3-c3ccncc3)cc2)n1 |
| InChI | InChI=1S/C22H24N6O/c1-3-20-25-22(29-27-20)18-6-4-16(5-7-18)8-11-24-14-19-15-28(2)26-21(19)17-9-12-23-13-10-17/h4-7,9-10,12-13,15,24H,3,8,11,14H2,1-2H3 |
| InChIKey | GKJPPIPZMCQFFI-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 81.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.48 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|