About 2-[(3R,4S)-3-ethyl-1-(4-fluorobenzoyl)piperidin-4-yl]acetic acid
2-[(3R,4S)-3-ethyl-1-(4-fluorobenzoyl)piperidin-4-yl]acetic acid (PubChem CID 11912373) has the molecular formula C16H20FNO3
and a molecular weight of 293.34 g/mol. Its IUPAC name is 2-[(3R,4S)-3-ethyl-1-(4-fluorobenzoyl)piperidin-4-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[(3R,4S)-3-ethyl-1-(4-fluorobenzoyl)piperidin-4-yl]acetic acid |
| PubChem CID | 11912373 |
| Molecular Formula | C16H20FNO3 |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 2-[(3R,4S)-3-ethyl-1-(4-fluorobenzoyl)piperidin-4-yl]acetic acid |
| SMILES | CC[C@H]1CN(C(=O)c2ccc(F)cc2)CC[C@H]1CC(=O)O |
| InChI | InChI=1S/C16H20FNO3/c1-2-11-10-18(8-7-13(11)9-15(19)20)16(21)12-3-5-14(17)6-4-12/h3-6,11,13H,2,7-10H2,1H3,(H,19,20)/t11-,13-/m0/s1 |
| InChIKey | VZVVFPLACJCCPL-AAEUAGOBSA-N |
| XLogP | 2.79 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(3R,4S)-3-ethyl-1-(4-fluorobenzoyl)piperidin-4-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3R,4S)-3-ethyl-1-(4-fluorobenzoyl)piperidin-4-yl]acetic acid?
The IUPAC name of 2-[(3R,4S)-3-ethyl-1-(4-fluorobenzoyl)piperidin-4-yl]acetic acid (CID 11912373) is 2-[(3R,4S)-3-ethyl-1-(4-fluorobenzoyl)piperidin-4-yl]acetic acid.
What is the SMILES notation for 2-[(3R,4S)-3-ethyl-1-(4-fluorobenzoyl)piperidin-4-yl]acetic acid?
The canonical SMILES for 2-[(3R,4S)-3-ethyl-1-(4-fluorobenzoyl)piperidin-4-yl]acetic acid is CC[C@H]1CN(C(=O)c2ccc(F)cc2)CC[C@H]1CC(=O)O.
What is the InChIKey of 2-[(3R,4S)-3-ethyl-1-(4-fluorobenzoyl)piperidin-4-yl]acetic acid?
The InChIKey is VZVVFPLACJCCPL-AAEUAGOBSA-N. The full InChI is InChI=1S/C16H20FNO3/c1-2-11-10-18(8-7-13(11)9-15(19)20)16(21)12-3-5-14(17)6-4-12/h3-6,11,13H,2,7-10H2,1H3,(H,19,20)/t11-,13-/m0/s1.
What are the key properties of 2-[(3R,4S)-3-ethyl-1-(4-fluorobenzoyl)piperidin-4-yl]acetic acid?
2-[(3R,4S)-3-ethyl-1-(4-fluorobenzoyl)piperidin-4-yl]acetic acid has a molecular weight of 293.34 g/mol, XLogP of 2.79, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3R,4S)-3-ethyl-1-(4-fluorobenzoyl)piperidin-4-yl]acetic acid is sourced from PubChem (CID 11912373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).