C13H17N2O4- — CID 11912380
2-[(3R,4S)-3-ethyl-1-(1,2-oxazole-5-carbonyl)piperidin-4-yl]acetate (PubChem CID 11912380) has the molecular formula C13H17N2O4- and a molecular weight of 265.29 g/mol. Its IUPAC name is 2-[(3R,4S)-3-ethyl-1-(1,2-oxazole-5-carbonyl)piperidin-4-yl]acetate.
| Compound Name | 2-[(3R,4S)-3-ethyl-1-(1,2-oxazole-5-carbonyl)piperidin-4-yl]acetate |
|---|---|
| PubChem CID | 11912380 |
| Molecular Formula | C13H17N2O4- |
| Molecular Weight | 265.29 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | 2-[(3R,4S)-3-ethyl-1-(1,2-oxazole-5-carbonyl)piperidin-4-yl]acetate |
| SMILES | CC[C@H]1CN(C(=O)c2ccno2)CC[C@H]1CC(=O)[O-] |
| InChI | InChI=1S/C13H18N2O4/c1-2-9-8-15(6-4-10(9)7-12(16)17)13(18)11-3-5-14-19-11/h3,5,9-10H,2,4,6-8H2,1H3,(H,16,17)/p-1/t9-,10-/m0/s1 |
| InChIKey | XIEPDRSFBRGFPA-UWVGGRQHSA-M |
| XLogP | 0.30 |
| TPSA | 86.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.29 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |