C18H26N4 — CID 119124241
N-[(1-methylbenzimidazol-2-yl)methyl]-1-(2-methylprop-2-enyl)piperidin-4-amine (PubChem CID 119124241) has the molecular formula C18H26N4 and a molecular weight of 298.43 g/mol. Its IUPAC name is N-[(1-methylbenzimidazol-2-yl)methyl]-1-(2-methylprop-2-enyl)piperidin-4-amine.
| Compound Name | N-[(1-methylbenzimidazol-2-yl)methyl]-1-(2-methylprop-2-enyl)piperidin-4-amine |
|---|---|
| PubChem CID | 119124241 |
| Molecular Formula | C18H26N4 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.22 |
| IUPAC Name | N-[(1-methylbenzimidazol-2-yl)methyl]-1-(2-methylprop-2-enyl)piperidin-4-amine |
| SMILES | C=C(C)CN1CCC(NCc2nc3ccccc3n2C)CC1 |
| InChI | InChI=1S/C18H26N4/c1-14(2)13-22-10-8-15(9-11-22)19-12-18-20-16-6-4-5-7-17(16)21(18)3/h4-7,15,19H,1,8-13H2,2-3H3 |
| InChIKey | IXVYGFKUZHAHAW-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|