C18H26N2O3 — CID 119124428
N-[(7-methoxy-1,3-benzodioxol-5-yl)methyl]-1-(2-methylprop-2-enyl)piperidin-4-amine (PubChem CID 119124428) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is N-[(7-methoxy-1,3-benzodioxol-5-yl)methyl]-1-(2-methylprop-2-enyl)piperidin-4-amine.
| Compound Name | N-[(7-methoxy-1,3-benzodioxol-5-yl)methyl]-1-(2-methylprop-2-enyl)piperidin-4-amine |
|---|---|
| PubChem CID | 119124428 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | N-[(7-methoxy-1,3-benzodioxol-5-yl)methyl]-1-(2-methylprop-2-enyl)piperidin-4-amine |
| SMILES | C=C(C)CN1CCC(NCc2cc(OC)c3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C18H26N2O3/c1-13(2)11-20-6-4-15(5-7-20)19-10-14-8-16(21-3)18-17(9-14)22-12-23-18/h8-9,15,19H,1,4-7,10-12H2,2-3H3 |
| InChIKey | GMOLOGUTBXUDEP-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|