C16H23N3O5 — CID 119124659
4-[[(4-cyclopropylmorpholin-2-yl)methylamino]methyl]-2-methoxy-5-nitrophenol (PubChem CID 119124659) has the molecular formula C16H23N3O5 and a molecular weight of 337.38 g/mol. Its IUPAC name is 4-[[(4-cyclopropylmorpholin-2-yl)methylamino]methyl]-2-methoxy-5-nitrophenol.
| Compound Name | 4-[[(4-cyclopropylmorpholin-2-yl)methylamino]methyl]-2-methoxy-5-nitrophenol |
|---|---|
| PubChem CID | 119124659 |
| Molecular Formula | C16H23N3O5 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | 4-[[(4-cyclopropylmorpholin-2-yl)methylamino]methyl]-2-methoxy-5-nitrophenol |
| SMILES | COc1cc(CNCC2CN(C3CC3)CCO2)c([N+](=O)[O-])cc1O |
| InChI | InChI=1S/C16H23N3O5/c1-23-16-6-11(14(19(21)22)7-15(16)20)8-17-9-13-10-18(4-5-24-13)12-2-3-12/h6-7,12-13,17,20H,2-5,8-10H2,1H3 |
| InChIKey | AXDUYDNTSPZWMW-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 97.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|