C19H22N2 — CID 119125336
1-(3,5-dimethylphenyl)-N-(1H-indol-4-ylmethyl)ethanamine (PubChem CID 119125336) has the molecular formula C19H22N2 and a molecular weight of 278.40 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-N-(1H-indol-4-ylmethyl)ethanamine.
| Compound Name | 1-(3,5-dimethylphenyl)-N-(1H-indol-4-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 119125336 |
| Molecular Formula | C19H22N2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-N-(1H-indol-4-ylmethyl)ethanamine |
| SMILES | Cc1cc(C)cc(C(C)NCc2cccc3[nH]ccc23)c1 |
| InChI | InChI=1S/C19H22N2/c1-13-9-14(2)11-17(10-13)15(3)21-12-16-5-4-6-19-18(16)7-8-20-19/h4-11,15,20-21H,12H2,1-3H3 |
| InChIKey | QNYXOAVRNYGNOI-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |