C24H32N2O3 — CID 119125906
1-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-4-[(2,3-dimethylphenyl)methylamino]butan-1-one (PubChem CID 119125906) has the molecular formula C24H32N2O3 and a molecular weight of 396.53 g/mol. Its IUPAC name is 1-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-4-[(2,3-dimethylphenyl)methylamino]butan-1-one.
| Compound Name | 1-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-4-[(2,3-dimethylphenyl)methylamino]butan-1-one |
|---|---|
| PubChem CID | 119125906 |
| Molecular Formula | C24H32N2O3 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.24 |
| IUPAC Name | 1-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-4-[(2,3-dimethylphenyl)methylamino]butan-1-one |
| SMILES | COc1cc2c(cc1OC)CN(C(=O)CCCNCc1cccc(C)c1C)CC2 |
| InChI | InChI=1S/C24H32N2O3/c1-17-7-5-8-20(18(17)2)15-25-11-6-9-24(27)26-12-10-19-13-22(28-3)23(29-4)14-21(19)16-26/h5,7-8,13-14,25H,6,9-12,15-16H2,1-4H3 |
| InChIKey | IBRCKCNQZYRUEQ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|