C18H21F3N2O — CID 119126444
1-(3-methoxyphenyl)-N,N-dimethyl-N'-[(3,4,5-trifluorophenyl)methyl]ethane-1,2-diamine (PubChem CID 119126444) has the molecular formula C18H21F3N2O and a molecular weight of 338.37 g/mol. Its IUPAC name is 1-(3-methoxyphenyl)-N,N-dimethyl-N'-[(3,4,5-trifluorophenyl)methyl]ethane-1,2-diamine.
| Compound Name | 1-(3-methoxyphenyl)-N,N-dimethyl-N'-[(3,4,5-trifluorophenyl)methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 119126444 |
| Molecular Formula | C18H21F3N2O |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 1-(3-methoxyphenyl)-N,N-dimethyl-N'-[(3,4,5-trifluorophenyl)methyl]ethane-1,2-diamine |
| SMILES | COc1cccc(C(CNCc2cc(F)c(F)c(F)c2)N(C)C)c1 |
| InChI | InChI=1S/C18H21F3N2O/c1-23(2)17(13-5-4-6-14(9-13)24-3)11-22-10-12-7-15(19)18(21)16(20)8-12/h4-9,17,22H,10-11H2,1-3H3 |
| InChIKey | POHMZFNMJAJJIO-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|