C14H21FN2O2 — CID 119127723
2-[(3-fluoro-4-methoxyphenyl)methylamino]-3,3-dimethylbutanamide (PubChem CID 119127723) has the molecular formula C14H21FN2O2 and a molecular weight of 268.33 g/mol. Its IUPAC name is 2-[(3-fluoro-4-methoxyphenyl)methylamino]-3,3-dimethylbutanamide.
| Compound Name | 2-[(3-fluoro-4-methoxyphenyl)methylamino]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 119127723 |
| Molecular Formula | C14H21FN2O2 |
| Molecular Weight | 268.33 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | 2-[(3-fluoro-4-methoxyphenyl)methylamino]-3,3-dimethylbutanamide |
| SMILES | COc1ccc(CNC(C(N)=O)C(C)(C)C)cc1F |
| InChI | InChI=1S/C14H21FN2O2/c1-14(2,3)12(13(16)18)17-8-9-5-6-11(19-4)10(15)7-9/h5-7,12,17H,8H2,1-4H3,(H2,16,18) |
| InChIKey | UCEPTVYNMHOHTJ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.33 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |