C18H23NO4 — CID 119128018
1-(4-phenyloxane-4-carbonyl)piperidine-3-carboxylic acid (PubChem CID 119128018) has the molecular formula C18H23NO4 and a molecular weight of 317.38 g/mol. Its IUPAC name is 1-(4-phenyloxane-4-carbonyl)piperidine-3-carboxylic acid.
| Compound Name | 1-(4-phenyloxane-4-carbonyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 119128018 |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | 1-(4-phenyloxane-4-carbonyl)piperidine-3-carboxylic acid |
| SMILES | O=C(O)C1CCCN(C(=O)C2(c3ccccc3)CCOCC2)C1 |
| InChI | InChI=1S/C18H23NO4/c20-16(21)14-5-4-10-19(13-14)17(22)18(8-11-23-12-9-18)15-6-2-1-3-7-15/h1-3,6-7,14H,4-5,8-13H2,(H,20,21) |
| InChIKey | SQRWRTNWOJMKSX-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |