C22H27N5O5 — CID 11912818
N-[(3S,3aR,6S,6aR)-3-[[4-(4-methoxyphenyl)pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]morpholine-4-carboxamide (PubChem CID 11912818) has the molecular formula C22H27N5O5 and a molecular weight of 441.49 g/mol. Its IUPAC name is N-[(3S,3aR,6S,6aR)-3-[[4-(4-methoxyphenyl)pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]morpholine-4-carboxamide.
| Compound Name | N-[(3S,3aR,6S,6aR)-3-[[4-(4-methoxyphenyl)pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 11912818 |
| Molecular Formula | C22H27N5O5 |
| Molecular Weight | 441.49 g/mol |
| Exact Mass | 441.20 |
| IUPAC Name | N-[(3S,3aR,6S,6aR)-3-[[4-(4-methoxyphenyl)pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]morpholine-4-carboxamide |
| SMILES | COc1ccc(-c2ccnc(N[C@H]3CO[C@H]4[C@@H]3OC[C@@H]4NC(=O)N3CCOCC3)n2)cc1 |
| InChI | InChI=1S/C22H27N5O5/c1-29-15-4-2-14(3-5-15)16-6-7-23-21(24-16)25-17-12-31-20-18(13-32-19(17)20)26-22(28)27-8-10-30-11-9-27/h2-7,17-20H,8-13H2,1H3,(H,26,28)(H,23,24,25)/t17-,18-,19+,20+/m0/s1 |
| InChIKey | NCRIVZILYIBBLP-VNTMZGSJSA-N |
| XLogP | 1.14 |
| TPSA | 107.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.49 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |