C16H26N4O — CID 119128338
3-[(3-methylcyclohexyl)methylamino]-1-(1-methylpyrazol-4-yl)pyrrolidin-2-one (PubChem CID 119128338) has the molecular formula C16H26N4O and a molecular weight of 290.41 g/mol. Its IUPAC name is 3-[(3-methylcyclohexyl)methylamino]-1-(1-methylpyrazol-4-yl)pyrrolidin-2-one.
| Compound Name | 3-[(3-methylcyclohexyl)methylamino]-1-(1-methylpyrazol-4-yl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 119128338 |
| Molecular Formula | C16H26N4O |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.21 |
| IUPAC Name | 3-[(3-methylcyclohexyl)methylamino]-1-(1-methylpyrazol-4-yl)pyrrolidin-2-one |
| SMILES | CC1CCCC(CNC2CCN(c3cnn(C)c3)C2=O)C1 |
| InChI | InChI=1S/C16H26N4O/c1-12-4-3-5-13(8-12)9-17-15-6-7-20(16(15)21)14-10-18-19(2)11-14/h10-13,15,17H,3-9H2,1-2H3 |
| InChIKey | TWBCLGDEONIXBK-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |