C17H23BrN4 — CID 119128419
N-[[5-(3-bromophenyl)-1H-imidazol-2-yl]methyl]-1-(1-ethylpyrrolidin-3-yl)methanamine (PubChem CID 119128419) has the molecular formula C17H23BrN4 and a molecular weight of 363.30 g/mol. Its IUPAC name is N-[[5-(3-bromophenyl)-1H-imidazol-2-yl]methyl]-1-(1-ethylpyrrolidin-3-yl)methanamine.
| Compound Name | N-[[5-(3-bromophenyl)-1H-imidazol-2-yl]methyl]-1-(1-ethylpyrrolidin-3-yl)methanamine |
|---|---|
| PubChem CID | 119128419 |
| Molecular Formula | C17H23BrN4 |
| Molecular Weight | 363.30 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | N-[[5-(3-bromophenyl)-1H-imidazol-2-yl]methyl]-1-(1-ethylpyrrolidin-3-yl)methanamine |
| SMILES | CCN1CCC(CNCc2ncc(-c3cccc(Br)c3)[nH]2)C1 |
| InChI | InChI=1S/C17H23BrN4/c1-2-22-7-6-13(12-22)9-19-11-17-20-10-16(21-17)14-4-3-5-15(18)8-14/h3-5,8,10,13,19H,2,6-7,9,11-12H2,1H3,(H,20,21) |
| InChIKey | MHZZUIXJOMTVMU-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.30 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |