C15H16Cl2N2O2 — CID 119129007
2-[(2,3-dichlorophenyl)methylamino]-N-(furan-2-ylmethyl)propanamide (PubChem CID 119129007) has the molecular formula C15H16Cl2N2O2 and a molecular weight of 327.21 g/mol. Its IUPAC name is 2-[(2,3-dichlorophenyl)methylamino]-N-(furan-2-ylmethyl)propanamide.
| Compound Name | 2-[(2,3-dichlorophenyl)methylamino]-N-(furan-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 119129007 |
| Molecular Formula | C15H16Cl2N2O2 |
| Molecular Weight | 327.21 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | 2-[(2,3-dichlorophenyl)methylamino]-N-(furan-2-ylmethyl)propanamide |
| SMILES | CC(NCc1cccc(Cl)c1Cl)C(=O)NCc1ccco1 |
| InChI | InChI=1S/C15H16Cl2N2O2/c1-10(15(20)19-9-12-5-3-7-21-12)18-8-11-4-2-6-13(16)14(11)17/h2-7,10,18H,8-9H2,1H3,(H,19,20) |
| InChIKey | YQOOGWIHQQNRMK-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.21 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |