C21H28N4O2S — CID 11912908
(3S,3aR,6S,6aR)-3-N-(cyclohexylmethyl)-6-N-(4-thiophen-2-ylpyrimidin-2-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3,6-diamine (PubChem CID 11912908) has the molecular formula C21H28N4O2S and a molecular weight of 400.55 g/mol. Its IUPAC name is (3S,3aR,6S,6aR)-3-N-(cyclohexylmethyl)-6-N-(4-thiophen-2-ylpyrimidin-2-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3,6-diamine.
| Compound Name | (3S,3aR,6S,6aR)-3-N-(cyclohexylmethyl)-6-N-(4-thiophen-2-ylpyrimidin-2-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3,6-diamine |
|---|---|
| PubChem CID | 11912908 |
| Molecular Formula | C21H28N4O2S |
| Molecular Weight | 400.55 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | (3S,3aR,6S,6aR)-3-N-(cyclohexylmethyl)-6-N-(4-thiophen-2-ylpyrimidin-2-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3,6-diamine |
| SMILES | c1csc(-c2ccnc(N[C@H]3CO[C@H]4[C@@H]3OC[C@@H]4NCC3CCCCC3)n2)c1 |
| InChI | InChI=1S/C21H28N4O2S/c1-2-5-14(6-3-1)11-23-16-12-26-20-17(13-27-19(16)20)25-21-22-9-8-15(24-21)18-7-4-10-28-18/h4,7-10,14,16-17,19-20,23H,1-3,5-6,11-13H2,(H,22,24,25)/t16-,17-,19+,20+/m0/s1 |
| InChIKey | BTRBQBJILDTZOX-RAUXBKROSA-N |
| XLogP | 3.32 |
| TPSA | 68.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.55 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |