C17H18N4O5 — CID 119129371
methyl 4-(5-carbamoyl-1-phenylpyrazole-3-carbonyl)morpholine-2-carboxylate (PubChem CID 119129371) has the molecular formula C17H18N4O5 and a molecular weight of 358.35 g/mol. Its IUPAC name is methyl 4-(5-carbamoyl-1-phenylpyrazole-3-carbonyl)morpholine-2-carboxylate.
| Compound Name | methyl 4-(5-carbamoyl-1-phenylpyrazole-3-carbonyl)morpholine-2-carboxylate |
|---|---|
| PubChem CID | 119129371 |
| Molecular Formula | C17H18N4O5 |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | methyl 4-(5-carbamoyl-1-phenylpyrazole-3-carbonyl)morpholine-2-carboxylate |
| SMILES | COC(=O)C1CN(C(=O)c2cc(C(N)=O)n(-c3ccccc3)n2)CCO1 |
| InChI | InChI=1S/C17H18N4O5/c1-25-17(24)14-10-20(7-8-26-14)16(23)12-9-13(15(18)22)21(19-12)11-5-3-2-4-6-11/h2-6,9,14H,7-8,10H2,1H3,(H2,18,22) |
| InChIKey | FAWMLXOISLLDLF-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 116.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |