C20H21FN4O3 — CID 119129476
4-[(carbamoylamino)methyl]-N-[1-(2-fluorophenyl)-2-oxopyrrolidin-3-yl]-N-methylbenzamide (PubChem CID 119129476) has the molecular formula C20H21FN4O3 and a molecular weight of 384.41 g/mol. Its IUPAC name is 4-[(carbamoylamino)methyl]-N-[1-(2-fluorophenyl)-2-oxopyrrolidin-3-yl]-N-methylbenzamide.
| Compound Name | 4-[(carbamoylamino)methyl]-N-[1-(2-fluorophenyl)-2-oxopyrrolidin-3-yl]-N-methylbenzamide |
|---|---|
| PubChem CID | 119129476 |
| Molecular Formula | C20H21FN4O3 |
| Molecular Weight | 384.41 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | 4-[(carbamoylamino)methyl]-N-[1-(2-fluorophenyl)-2-oxopyrrolidin-3-yl]-N-methylbenzamide |
| SMILES | CN(C(=O)c1ccc(CNC(N)=O)cc1)C1CCN(c2ccccc2F)C1=O |
| InChI | InChI=1S/C20H21FN4O3/c1-24(18(26)14-8-6-13(7-9-14)12-23-20(22)28)17-10-11-25(19(17)27)16-5-3-2-4-15(16)21/h2-9,17H,10-12H2,1H3,(H3,22,23,28) |
| InChIKey | OXPCLBLBLUERBL-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.41 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |