C16H23N3O3 — CID 119130031
[3-[3-(ethoxymethyl)piperidine-1-carbonyl]phenyl]urea (PubChem CID 119130031) has the molecular formula C16H23N3O3 and a molecular weight of 305.38 g/mol. Its IUPAC name is [3-[3-(ethoxymethyl)piperidine-1-carbonyl]phenyl]urea.
| Compound Name | [3-[3-(ethoxymethyl)piperidine-1-carbonyl]phenyl]urea |
|---|---|
| PubChem CID | 119130031 |
| Molecular Formula | C16H23N3O3 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | [3-[3-(ethoxymethyl)piperidine-1-carbonyl]phenyl]urea |
| SMILES | CCOCC1CCCN(C(=O)c2cccc(NC(N)=O)c2)C1 |
| InChI | InChI=1S/C16H23N3O3/c1-2-22-11-12-5-4-8-19(10-12)15(20)13-6-3-7-14(9-13)18-16(17)21/h3,6-7,9,12H,2,4-5,8,10-11H2,1H3,(H3,17,18,21) |
| InChIKey | YUPLWNKWXFTAIC-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |