C22H26N4O3 — CID 11913025
N-[(3S,3aR,6S,6aR)-3-[(4-cyclopentylpyrimidin-2-yl)amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]benzamide (PubChem CID 11913025) has the molecular formula C22H26N4O3 and a molecular weight of 394.48 g/mol. Its IUPAC name is N-[(3S,3aR,6S,6aR)-3-[(4-cyclopentylpyrimidin-2-yl)amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]benzamide.
| Compound Name | N-[(3S,3aR,6S,6aR)-3-[(4-cyclopentylpyrimidin-2-yl)amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]benzamide |
|---|---|
| PubChem CID | 11913025 |
| Molecular Formula | C22H26N4O3 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | N-[(3S,3aR,6S,6aR)-3-[(4-cyclopentylpyrimidin-2-yl)amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]benzamide |
| SMILES | O=C(N[C@H]1CO[C@H]2[C@@H]1OC[C@@H]2Nc1nccc(C2CCCC2)n1)c1ccccc1 |
| InChI | InChI=1S/C22H26N4O3/c27-21(15-8-2-1-3-9-15)24-17-12-28-20-18(13-29-19(17)20)26-22-23-11-10-16(25-22)14-6-4-5-7-14/h1-3,8-11,14,17-20H,4-7,12-13H2,(H,24,27)(H,23,25,26)/t17-,18-,19+,20+/m0/s1 |
| InChIKey | CLRBORKZMSLTCI-VNTMZGSJSA-N |
| XLogP | 2.51 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |