C17H24N8 — CID 119130984
N'-methyl-N-[2-(pyrazin-2-ylamino)ethyl]-4-pyridin-2-ylpiperazine-1-carboximidamide (PubChem CID 119130984) has the molecular formula C17H24N8 and a molecular weight of 340.44 g/mol. Its IUPAC name is N'-methyl-N-[2-(pyrazin-2-ylamino)ethyl]-4-pyridin-2-ylpiperazine-1-carboximidamide.
| Compound Name | N'-methyl-N-[2-(pyrazin-2-ylamino)ethyl]-4-pyridin-2-ylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 119130984 |
| Molecular Formula | C17H24N8 |
| Molecular Weight | 340.44 g/mol |
| Exact Mass | 340.21 |
| IUPAC Name | N'-methyl-N-[2-(pyrazin-2-ylamino)ethyl]-4-pyridin-2-ylpiperazine-1-carboximidamide |
| SMILES | C/N=C(\NCCNc1cnccn1)N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C17H24N8/c1-18-17(23-9-8-21-15-14-19-6-7-20-15)25-12-10-24(11-13-25)16-4-2-3-5-22-16/h2-7,14H,8-13H2,1H3,(H,18,23)(H,20,21) |
| InChIKey | MIKOHBHJLRQVJE-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 81.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.44 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|