About N-ethyl-4-(oxolane-2-carbonyl)-N'-[2-(1,2,4-triazol-1-yl)ethyl]piperazine-1-carboximidamide
N-ethyl-4-(oxolane-2-carbonyl)-N'-[2-(1,2,4-triazol-1-yl)ethyl]piperazine-1-carboximidamide (PubChem CID 119131822) has the molecular formula C16H27N7O2
and a molecular weight of 349.44 g/mol. Its IUPAC name is N-ethyl-4-(oxolane-2-carbonyl)-N'-[2-(1,2,4-triazol-1-yl)ethyl]piperazine-1-carboximidamide.
Molecular Properties
| Compound Name | N-ethyl-4-(oxolane-2-carbonyl)-N'-[2-(1,2,4-triazol-1-yl)ethyl]piperazine-1-carboximidamide |
| PubChem CID | 119131822 |
| Molecular Formula | C16H27N7O2 |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.22 |
| IUPAC Name | N-ethyl-4-(oxolane-2-carbonyl)-N'-[2-(1,2,4-triazol-1-yl)ethyl]piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CCn1cncn1)N1CCN(C(=O)C2CCCO2)CC1 |
| InChI | InChI=1S/C16H27N7O2/c1-2-18-16(19-5-6-23-13-17-12-20-23)22-9-7-21(8-10-22)15(24)14-4-3-11-25-14/h12-14H,2-11H2,1H3,(H,18,19) |
| InChIKey | AMWGQLZEWPEZAO-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 87.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-4-(oxolane-2-carbonyl)-N'-[2-(1,2,4-triazol-1-yl)ethyl]piperazine-1-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-4-(oxolane-2-carbonyl)-N'-[2-(1,2,4-triazol-1-yl)ethyl]piperazine-1-carboximidamide?
The IUPAC name of N-ethyl-4-(oxolane-2-carbonyl)-N'-[2-(1,2,4-triazol-1-yl)ethyl]piperazine-1-carboximidamide (CID 119131822) is N-ethyl-4-(oxolane-2-carbonyl)-N'-[2-(1,2,4-triazol-1-yl)ethyl]piperazine-1-carboximidamide.
What is the SMILES notation for N-ethyl-4-(oxolane-2-carbonyl)-N'-[2-(1,2,4-triazol-1-yl)ethyl]piperazine-1-carboximidamide?
The canonical SMILES for N-ethyl-4-(oxolane-2-carbonyl)-N'-[2-(1,2,4-triazol-1-yl)ethyl]piperazine-1-carboximidamide is CCN/C(=N\CCn1cncn1)N1CCN(C(=O)C2CCCO2)CC1.
What is the InChIKey of N-ethyl-4-(oxolane-2-carbonyl)-N'-[2-(1,2,4-triazol-1-yl)ethyl]piperazine-1-carboximidamide?
The InChIKey is AMWGQLZEWPEZAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27N7O2/c1-2-18-16(19-5-6-23-13-17-12-20-23)22-9-7-21(8-10-22)15(24)14-4-3-11-25-14/h12-14H,2-11H2,1H3,(H,18,19).
What are the key properties of N-ethyl-4-(oxolane-2-carbonyl)-N'-[2-(1,2,4-triazol-1-yl)ethyl]piperazine-1-carboximidamide?
N-ethyl-4-(oxolane-2-carbonyl)-N'-[2-(1,2,4-triazol-1-yl)ethyl]piperazine-1-carboximidamide has a molecular weight of 349.44 g/mol, XLogP of -0.43, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-4-(oxolane-2-carbonyl)-N'-[2-(1,2,4-triazol-1-yl)ethyl]piperazine-1-carboximidamide is sourced from PubChem (CID 119131822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).