C15H22BrIN6S — CID 119132943
1-[(5-bromothiophen-2-yl)methyl]-3-cyclopropyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-methylguanidine;hydroiodide (PubChem CID 119132943) has the molecular formula C15H22BrIN6S and a molecular weight of 525.26 g/mol. Its IUPAC name is 1-[(5-bromothiophen-2-yl)methyl]-3-cyclopropyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-methylguanidine;hydroiodide.
| Compound Name | 1-[(5-bromothiophen-2-yl)methyl]-3-cyclopropyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 119132943 |
| Molecular Formula | C15H22BrIN6S |
| Molecular Weight | 525.26 g/mol |
| Exact Mass | 523.99 |
| IUPAC Name | 1-[(5-bromothiophen-2-yl)methyl]-3-cyclopropyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-methylguanidine;hydroiodide |
| SMILES | Cc1nnc(C/N=C(/NC2CC2)N(C)Cc2ccc(Br)s2)n1C.I |
| InChI | InChI=1S/C15H21BrN6S.HI/c1-10-19-20-14(22(10)3)8-17-15(18-11-4-5-11)21(2)9-12-6-7-13(16)23-12;/h6-7,11H,4-5,8-9H2,1-3H3,(H,17,18);1H |
| InChIKey | VJQJTWJQKSWIMY-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 58.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.26 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|