C27H27N4O3+ — CID 11913316
[(3S,3aR,6S,6aR)-6-[[4-(4-phenylphenyl)pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-(furan-2-ylmethyl)azanium (PubChem CID 11913316) has the molecular formula C27H27N4O3+ and a molecular weight of 455.54 g/mol. Its IUPAC name is [(3S,3aR,6S,6aR)-6-[[4-(4-phenylphenyl)pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-(furan-2-ylmethyl)azanium.
| Compound Name | [(3S,3aR,6S,6aR)-6-[[4-(4-phenylphenyl)pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-(furan-2-ylmethyl)azanium |
|---|---|
| PubChem CID | 11913316 |
| Molecular Formula | C27H27N4O3+ |
| Molecular Weight | 455.54 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | [(3S,3aR,6S,6aR)-6-[[4-(4-phenylphenyl)pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-(furan-2-ylmethyl)azanium |
| SMILES | c1ccc(-c2ccc(-c3ccnc(N[C@H]4CO[C@H]5[C@@H]4OC[C@@H]5[NH2+]Cc4ccco4)n3)cc2)cc1 |
| InChI | InChI=1S/C27H26N4O3/c1-2-5-18(6-3-1)19-8-10-20(11-9-19)22-12-13-28-27(30-22)31-24-17-34-25-23(16-33-26(24)25)29-15-21-7-4-14-32-21/h1-14,23-26,29H,15-17H2,(H,28,30,31)/p+1/t23-,24-,25+,26+/m0/s1 |
| InChIKey | LMRKOLPPSBYGAD-QEGGNFSNSA-O |
| XLogP | 3.11 |
| TPSA | 86.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.54 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |