C18H27N4PS — CID 11913499
(3S,4E)-N,N-diethyl-2-methyl-3-sulfanylidene-4-(1,3,3-trimethylindol-2-ylidene)-1,2,3λ5-diazaphosphol-3-amine (PubChem CID 11913499) has the molecular formula C18H27N4PS and a molecular weight of 362.48 g/mol. Its IUPAC name is (3S,4E)-N,N-diethyl-2-methyl-3-sulfanylidene-4-(1,3,3-trimethylindol-2-ylidene)-1,2,3λ5-diazaphosphol-3-amine.
| Compound Name | (3S,4E)-N,N-diethyl-2-methyl-3-sulfanylidene-4-(1,3,3-trimethylindol-2-ylidene)-1,2,3λ5-diazaphosphol-3-amine |
|---|---|
| PubChem CID | 11913499 |
| Molecular Formula | C18H27N4PS |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | (3S,4E)-N,N-diethyl-2-methyl-3-sulfanylidene-4-(1,3,3-trimethylindol-2-ylidene)-1,2,3λ5-diazaphosphol-3-amine |
| SMILES | CCN(CC)[P@@]1(=S)/C(=C2/N(C)c3ccccc3C2(C)C)C=NN1C |
| InChI | InChI=1S/C18H27N4PS/c1-7-22(8-2)23(24)16(13-19-21(23)6)17-18(3,4)14-11-9-10-12-15(14)20(17)5/h9-13H,7-8H2,1-6H3/b17-16+/t23-/m1/s1 |
| InChIKey | BZNNIBFFVRNNEL-KXKTWFEWSA-N |
| XLogP | 4.21 |
| TPSA | 22.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|