About 4-[2-(4-methyl-1,3-thiazol-2-yl)piperidin-1-yl]butanoic acid
4-[2-(4-methyl-1,3-thiazol-2-yl)piperidin-1-yl]butanoic acid (PubChem CID 119135128) has the molecular formula C13H20N2O2S
and a molecular weight of 268.38 g/mol. Its IUPAC name is 4-[2-(4-methyl-1,3-thiazol-2-yl)piperidin-1-yl]butanoic acid.
Molecular Properties
| Compound Name | 4-[2-(4-methyl-1,3-thiazol-2-yl)piperidin-1-yl]butanoic acid |
| PubChem CID | 119135128 |
| Molecular Formula | C13H20N2O2S |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 4-[2-(4-methyl-1,3-thiazol-2-yl)piperidin-1-yl]butanoic acid |
| SMILES | Cc1csc(C2CCCCN2CCCC(=O)O)n1 |
| InChI | InChI=1S/C13H20N2O2S/c1-10-9-18-13(14-10)11-5-2-3-7-15(11)8-4-6-12(16)17/h9,11H,2-8H2,1H3,(H,16,17) |
| InChIKey | WXZYXLYXKCYJLJ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[2-(4-methyl-1,3-thiazol-2-yl)piperidin-1-yl]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(4-methyl-1,3-thiazol-2-yl)piperidin-1-yl]butanoic acid?
The IUPAC name of 4-[2-(4-methyl-1,3-thiazol-2-yl)piperidin-1-yl]butanoic acid (CID 119135128) is 4-[2-(4-methyl-1,3-thiazol-2-yl)piperidin-1-yl]butanoic acid.
What is the SMILES notation for 4-[2-(4-methyl-1,3-thiazol-2-yl)piperidin-1-yl]butanoic acid?
The canonical SMILES for 4-[2-(4-methyl-1,3-thiazol-2-yl)piperidin-1-yl]butanoic acid is Cc1csc(C2CCCCN2CCCC(=O)O)n1.
What is the InChIKey of 4-[2-(4-methyl-1,3-thiazol-2-yl)piperidin-1-yl]butanoic acid?
The InChIKey is WXZYXLYXKCYJLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2O2S/c1-10-9-18-13(14-10)11-5-2-3-7-15(11)8-4-6-12(16)17/h9,11H,2-8H2,1H3,(H,16,17).
What are the key properties of 4-[2-(4-methyl-1,3-thiazol-2-yl)piperidin-1-yl]butanoic acid?
4-[2-(4-methyl-1,3-thiazol-2-yl)piperidin-1-yl]butanoic acid has a molecular weight of 268.38 g/mol, XLogP of 2.84, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(4-methyl-1,3-thiazol-2-yl)piperidin-1-yl]butanoic acid is sourced from PubChem (CID 119135128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).