C10H20IN3O2 — CID 119135660
tert-butyl 2-(1,4,5,6-tetrahydropyrimidin-2-ylamino)acetate;hydroiodide (PubChem CID 119135660) has the molecular formula C10H20IN3O2 and a molecular weight of 341.19 g/mol. Its IUPAC name is tert-butyl 2-(1,4,5,6-tetrahydropyrimidin-2-ylamino)acetate;hydroiodide.
| Compound Name | tert-butyl 2-(1,4,5,6-tetrahydropyrimidin-2-ylamino)acetate;hydroiodide |
|---|---|
| PubChem CID | 119135660 |
| Molecular Formula | C10H20IN3O2 |
| Molecular Weight | 341.19 g/mol |
| Exact Mass | 341.06 |
| IUPAC Name | tert-butyl 2-(1,4,5,6-tetrahydropyrimidin-2-ylamino)acetate;hydroiodide |
| SMILES | CC(C)(C)OC(=O)CNC1=NCCCN1.I |
| InChI | InChI=1S/C10H19N3O2.HI/c1-10(2,3)15-8(14)7-13-9-11-5-4-6-12-9;/h4-7H2,1-3H3,(H2,11,12,13);1H |
| InChIKey | HZOYVIXNFXREJC-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.19 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|