C14H20N2O5S — CID 119136438
4-[[2-[benzenesulfonyl(methyl)amino]acetyl]-methylamino]butanoic acid (PubChem CID 119136438) has the molecular formula C14H20N2O5S and a molecular weight of 328.39 g/mol. Its IUPAC name is 4-[[2-[benzenesulfonyl(methyl)amino]acetyl]-methylamino]butanoic acid.
| Compound Name | 4-[[2-[benzenesulfonyl(methyl)amino]acetyl]-methylamino]butanoic acid |
|---|---|
| PubChem CID | 119136438 |
| Molecular Formula | C14H20N2O5S |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 4-[[2-[benzenesulfonyl(methyl)amino]acetyl]-methylamino]butanoic acid |
| SMILES | CN(CCCC(=O)O)C(=O)CN(C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C14H20N2O5S/c1-15(10-6-9-14(18)19)13(17)11-16(2)22(20,21)12-7-4-3-5-8-12/h3-5,7-8H,6,9-11H2,1-2H3,(H,18,19) |
| InChIKey | MWHKVIUEOIJMGZ-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |