C17H33NO — CID 11913672
(1S,9aR)-1-(2-methylhexan-2-yloxymethyl)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine (PubChem CID 11913672) has the molecular formula C17H33NO and a molecular weight of 267.46 g/mol. Its IUPAC name is (1S,9aR)-1-(2-methylhexan-2-yloxymethyl)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine.
| Compound Name | (1S,9aR)-1-(2-methylhexan-2-yloxymethyl)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine |
|---|---|
| PubChem CID | 11913672 |
| Molecular Formula | C17H33NO |
| Molecular Weight | 267.46 g/mol |
| Exact Mass | 267.26 |
| IUPAC Name | (1S,9aR)-1-(2-methylhexan-2-yloxymethyl)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine |
| SMILES | CCCCC(C)(C)OC[C@H]1CCCN2CCCC[C@H]12 |
| InChI | InChI=1S/C17H33NO/c1-4-5-11-17(2,3)19-14-15-9-8-13-18-12-7-6-10-16(15)18/h15-16H,4-14H2,1-3H3/t15-,16-/m1/s1 |
| InChIKey | NPZLLCONTPIWRD-HZPDHXFCSA-N |
| XLogP | 4.24 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.46 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |