C19H22N2O4S — CID 119136952
1-[2-[2-(5-methylfuran-2-yl)-1,3-thiazol-4-yl]acetyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid (PubChem CID 119136952) has the molecular formula C19H22N2O4S and a molecular weight of 374.46 g/mol. Its IUPAC name is 1-[2-[2-(5-methylfuran-2-yl)-1,3-thiazol-4-yl]acetyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid.
| Compound Name | 1-[2-[2-(5-methylfuran-2-yl)-1,3-thiazol-4-yl]acetyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid |
|---|---|
| PubChem CID | 119136952 |
| Molecular Formula | C19H22N2O4S |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | 1-[2-[2-(5-methylfuran-2-yl)-1,3-thiazol-4-yl]acetyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid |
| SMILES | Cc1ccc(-c2nc(CC(=O)N3C(C(=O)O)CC4CCCCC43)cs2)o1 |
| InChI | InChI=1S/C19H22N2O4S/c1-11-6-7-16(25-11)18-20-13(10-26-18)9-17(22)21-14-5-3-2-4-12(14)8-15(21)19(23)24/h6-7,10,12,14-15H,2-5,8-9H2,1H3,(H,23,24) |
| InChIKey | UNLHMGQMWFPGBP-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 83.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |