C15H22N2O4 — CID 119136993
2-[(4-acetyl-3-ethyl-5-methyl-1H-pyrrole-2-carbonyl)amino]-3-methylbutanoic acid (PubChem CID 119136993) has the molecular formula C15H22N2O4 and a molecular weight of 294.35 g/mol. Its IUPAC name is 2-[(4-acetyl-3-ethyl-5-methyl-1H-pyrrole-2-carbonyl)amino]-3-methylbutanoic acid.
| Compound Name | 2-[(4-acetyl-3-ethyl-5-methyl-1H-pyrrole-2-carbonyl)amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 119136993 |
| Molecular Formula | C15H22N2O4 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 2-[(4-acetyl-3-ethyl-5-methyl-1H-pyrrole-2-carbonyl)amino]-3-methylbutanoic acid |
| SMILES | CCc1c(C(=O)NC(C(=O)O)C(C)C)[nH]c(C)c1C(C)=O |
| InChI | InChI=1S/C15H22N2O4/c1-6-10-11(9(5)18)8(4)16-13(10)14(19)17-12(7(2)3)15(20)21/h7,12,16H,6H2,1-5H3,(H,17,19)(H,20,21) |
| InChIKey | DEHABLTUAHNTHV-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |