About 6-[3-(4,6-dimethyl-2-methylsulfanylpyrimidin-5-yl)propanoyl]-6-azaspiro[2.5]octane-2-carboxylic acid
6-[3-(4,6-dimethyl-2-methylsulfanylpyrimidin-5-yl)propanoyl]-6-azaspiro[2.5]octane-2-carboxylic acid (PubChem CID 119137382) has the molecular formula C18H25N3O3S
and a molecular weight of 363.48 g/mol. Its IUPAC name is 6-[3-(4,6-dimethyl-2-methylsulfanylpyrimidin-5-yl)propanoyl]-6-azaspiro[2.5]octane-2-carboxylic acid.
Molecular Properties
| Compound Name | 6-[3-(4,6-dimethyl-2-methylsulfanylpyrimidin-5-yl)propanoyl]-6-azaspiro[2.5]octane-2-carboxylic acid |
| PubChem CID | 119137382 |
| Molecular Formula | C18H25N3O3S |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 6-[3-(4,6-dimethyl-2-methylsulfanylpyrimidin-5-yl)propanoyl]-6-azaspiro[2.5]octane-2-carboxylic acid |
| SMILES | CSc1nc(C)c(CCC(=O)N2CCC3(CC2)CC3C(=O)O)c(C)n1 |
| InChI | InChI=1S/C18H25N3O3S/c1-11-13(12(2)20-17(19-11)25-3)4-5-15(22)21-8-6-18(7-9-21)10-14(18)16(23)24/h14H,4-10H2,1-3H3,(H,23,24) |
| InChIKey | ZOKTYRGGTPUIQG-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-[3-(4,6-dimethyl-2-methylsulfanylpyrimidin-5-yl)propanoyl]-6-azaspiro[2.5]octane-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[3-(4,6-dimethyl-2-methylsulfanylpyrimidin-5-yl)propanoyl]-6-azaspiro[2.5]octane-2-carboxylic acid?
The IUPAC name of 6-[3-(4,6-dimethyl-2-methylsulfanylpyrimidin-5-yl)propanoyl]-6-azaspiro[2.5]octane-2-carboxylic acid (CID 119137382) is 6-[3-(4,6-dimethyl-2-methylsulfanylpyrimidin-5-yl)propanoyl]-6-azaspiro[2.5]octane-2-carboxylic acid.
What is the SMILES notation for 6-[3-(4,6-dimethyl-2-methylsulfanylpyrimidin-5-yl)propanoyl]-6-azaspiro[2.5]octane-2-carboxylic acid?
The canonical SMILES for 6-[3-(4,6-dimethyl-2-methylsulfanylpyrimidin-5-yl)propanoyl]-6-azaspiro[2.5]octane-2-carboxylic acid is CSc1nc(C)c(CCC(=O)N2CCC3(CC2)CC3C(=O)O)c(C)n1.
What is the InChIKey of 6-[3-(4,6-dimethyl-2-methylsulfanylpyrimidin-5-yl)propanoyl]-6-azaspiro[2.5]octane-2-carboxylic acid?
The InChIKey is ZOKTYRGGTPUIQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25N3O3S/c1-11-13(12(2)20-17(19-11)25-3)4-5-15(22)21-8-6-18(7-9-21)10-14(18)16(23)24/h14H,4-10H2,1-3H3,(H,23,24).
What are the key properties of 6-[3-(4,6-dimethyl-2-methylsulfanylpyrimidin-5-yl)propanoyl]-6-azaspiro[2.5]octane-2-carboxylic acid?
6-[3-(4,6-dimethyl-2-methylsulfanylpyrimidin-5-yl)propanoyl]-6-azaspiro[2.5]octane-2-carboxylic acid has a molecular weight of 363.48 g/mol, XLogP of 2.46, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[3-(4,6-dimethyl-2-methylsulfanylpyrimidin-5-yl)propanoyl]-6-azaspiro[2.5]octane-2-carboxylic acid is sourced from PubChem (CID 119137382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).