C13H15ClN2O3S — CID 11913792
(4aR,7aR)-1-(3-chloro-4-methylphenyl)-6,6-dioxo-2,4,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-3-one (PubChem CID 11913792) has the molecular formula C13H15ClN2O3S and a molecular weight of 314.79 g/mol. Its IUPAC name is (4aR,7aR)-1-(3-chloro-4-methylphenyl)-6,6-dioxo-2,4,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-3-one.
| Compound Name | (4aR,7aR)-1-(3-chloro-4-methylphenyl)-6,6-dioxo-2,4,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-3-one |
|---|---|
| PubChem CID | 11913792 |
| Molecular Formula | C13H15ClN2O3S |
| Molecular Weight | 314.79 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | (4aR,7aR)-1-(3-chloro-4-methylphenyl)-6,6-dioxo-2,4,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-3-one |
| SMILES | Cc1ccc(N2CC(=O)N[C@H]3CS(=O)(=O)C[C@@H]32)cc1Cl |
| InChI | InChI=1S/C13H15ClN2O3S/c1-8-2-3-9(4-10(8)14)16-5-13(17)15-11-6-20(18,19)7-12(11)16/h2-4,11-12H,5-7H2,1H3,(H,15,17)/t11-,12-/m0/s1 |
| InChIKey | YDLVTWODJUFORV-RYUDHWBXSA-N |
| XLogP | 0.75 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.79 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |