C22H25N3O2 — CID 119138574
tert-butyl 4-[[(5-phenyl-1H-pyrazol-4-yl)methylamino]methyl]benzoate (PubChem CID 119138574) has the molecular formula C22H25N3O2 and a molecular weight of 363.46 g/mol. Its IUPAC name is tert-butyl 4-[[(5-phenyl-1H-pyrazol-4-yl)methylamino]methyl]benzoate.
| Compound Name | tert-butyl 4-[[(5-phenyl-1H-pyrazol-4-yl)methylamino]methyl]benzoate |
|---|---|
| PubChem CID | 119138574 |
| Molecular Formula | C22H25N3O2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | tert-butyl 4-[[(5-phenyl-1H-pyrazol-4-yl)methylamino]methyl]benzoate |
| SMILES | CC(C)(C)OC(=O)c1ccc(CNCc2cn[nH]c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C22H25N3O2/c1-22(2,3)27-21(26)18-11-9-16(10-12-18)13-23-14-19-15-24-25-20(19)17-7-5-4-6-8-17/h4-12,15,23H,13-14H2,1-3H3,(H,24,25) |
| InChIKey | DKAFOAVOSJGSLF-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |