C16H22N4O3 — CID 119138675
1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)-N-[(4-methyl-3-nitrophenyl)methyl]ethanamine (PubChem CID 119138675) has the molecular formula C16H22N4O3 and a molecular weight of 318.38 g/mol. Its IUPAC name is 1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)-N-[(4-methyl-3-nitrophenyl)methyl]ethanamine.
| Compound Name | 1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)-N-[(4-methyl-3-nitrophenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 119138675 |
| Molecular Formula | C16H22N4O3 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | 1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)-N-[(4-methyl-3-nitrophenyl)methyl]ethanamine |
| SMILES | Cc1ccc(CNC(C)c2nc(C(C)(C)C)no2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H22N4O3/c1-10-6-7-12(8-13(10)20(21)22)9-17-11(2)14-18-15(19-23-14)16(3,4)5/h6-8,11,17H,9H2,1-5H3 |
| InChIKey | BAPSJLUKJCDCFX-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|