C19H24N4S — CID 119139670
N-[(5-ethyl-1,3-thiazol-2-yl)methyl]-N'-methyl-4-phenyl-3,6-dihydro-2H-pyridine-1-carboximidamide (PubChem CID 119139670) has the molecular formula C19H24N4S and a molecular weight of 340.50 g/mol. Its IUPAC name is N-[(5-ethyl-1,3-thiazol-2-yl)methyl]-N'-methyl-4-phenyl-3,6-dihydro-2H-pyridine-1-carboximidamide.
| Compound Name | N-[(5-ethyl-1,3-thiazol-2-yl)methyl]-N'-methyl-4-phenyl-3,6-dihydro-2H-pyridine-1-carboximidamide |
|---|---|
| PubChem CID | 119139670 |
| Molecular Formula | C19H24N4S |
| Molecular Weight | 340.50 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | N-[(5-ethyl-1,3-thiazol-2-yl)methyl]-N'-methyl-4-phenyl-3,6-dihydro-2H-pyridine-1-carboximidamide |
| SMILES | CCc1cnc(CN/C(=N\C)N2CC=C(c3ccccc3)CC2)s1 |
| InChI | InChI=1S/C19H24N4S/c1-3-17-13-21-18(24-17)14-22-19(20-2)23-11-9-16(10-12-23)15-7-5-4-6-8-15/h4-9,13H,3,10-12,14H2,1-2H3,(H,20,22) |
| InChIKey | STUOKRUPIXSVNT-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 40.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.50 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|