C18H26ClIN4O2S — CID 119139715
4-[(5-chlorothiophen-2-yl)methyl]-N-[2-(furan-2-yl)-2-hydroxypropyl]-N'-methylpiperazine-1-carboximidamide;hydroiodide (PubChem CID 119139715) has the molecular formula C18H26ClIN4O2S and a molecular weight of 524.86 g/mol. Its IUPAC name is 4-[(5-chlorothiophen-2-yl)methyl]-N-[2-(furan-2-yl)-2-hydroxypropyl]-N'-methylpiperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-[(5-chlorothiophen-2-yl)methyl]-N-[2-(furan-2-yl)-2-hydroxypropyl]-N'-methylpiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 119139715 |
| Molecular Formula | C18H26ClIN4O2S |
| Molecular Weight | 524.86 g/mol |
| Exact Mass | 524.05 |
| IUPAC Name | 4-[(5-chlorothiophen-2-yl)methyl]-N-[2-(furan-2-yl)-2-hydroxypropyl]-N'-methylpiperazine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCC(C)(O)c1ccco1)N1CCN(Cc2ccc(Cl)s2)CC1.I |
| InChI | InChI=1S/C18H25ClN4O2S.HI/c1-18(24,15-4-3-11-25-15)13-21-17(20-2)23-9-7-22(8-10-23)12-14-5-6-16(19)26-14;/h3-6,11,24H,7-10,12-13H2,1-2H3,(H,20,21);1H |
| InChIKey | IXTAVXULKAVIQQ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 64.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.86 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|