C27H28FN2O+ — CID 11914109
[(4aS,9bS)-2-benzyl-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-2-ium-5-yl]-(4-fluorophenyl)methanone (PubChem CID 11914109) has the molecular formula C27H28FN2O+ and a molecular weight of 415.53 g/mol. Its IUPAC name is [(4aS,9bS)-2-benzyl-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-2-ium-5-yl]-(4-fluorophenyl)methanone.
| Compound Name | [(4aS,9bS)-2-benzyl-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-2-ium-5-yl]-(4-fluorophenyl)methanone |
|---|---|
| PubChem CID | 11914109 |
| Molecular Formula | C27H28FN2O+ |
| Molecular Weight | 415.53 g/mol |
| Exact Mass | 415.22 |
| IUPAC Name | [(4aS,9bS)-2-benzyl-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-2-ium-5-yl]-(4-fluorophenyl)methanone |
| SMILES | Cc1ccc2c(c1)[C@H]1C[N+](C)(Cc3ccccc3)CC[C@@H]1N2C(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C27H28FN2O/c1-19-8-13-25-23(16-19)24-18-30(2,17-20-6-4-3-5-7-20)15-14-26(24)29(25)27(31)21-9-11-22(28)12-10-21/h3-13,16,24,26H,14-15,17-18H2,1-2H3/q+1/t24-,26+,30?/m1/s1 |
| InChIKey | NAWJCFHFONIOEE-MJAHCGDXSA-N |
| XLogP | 5.30 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.53 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|