C15H20F3IN6S — CID 119141274
2-methyl-1-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-ylmethyl)-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide (PubChem CID 119141274) has the molecular formula C15H20F3IN6S and a molecular weight of 500.33 g/mol. Its IUPAC name is 2-methyl-1-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-ylmethyl)-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-ylmethyl)-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 119141274 |
| Molecular Formula | C15H20F3IN6S |
| Molecular Weight | 500.33 g/mol |
| Exact Mass | 500.05 |
| IUPAC Name | 2-methyl-1-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-ylmethyl)-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1cn2c(n1)CCCC2)NCc1nc(C(F)(F)F)cs1.I |
| InChI | InChI=1S/C15H19F3N6S.HI/c1-19-14(21-7-13-23-11(9-25-13)15(16,17)18)20-6-10-8-24-5-3-2-4-12(24)22-10;/h8-9H,2-7H2,1H3,(H2,19,20,21);1H |
| InChIKey | RNLVZJQOUXUUID-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.33 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|