About 9-benzyl-N-cyclopropyl-N'-methyl-2,9-diazaspiro[4.5]decane-2-carboximidamide
9-benzyl-N-cyclopropyl-N'-methyl-2,9-diazaspiro[4.5]decane-2-carboximidamide (PubChem CID 119143302) has the molecular formula C20H30N4
and a molecular weight of 326.49 g/mol. Its IUPAC name is 9-benzyl-N-cyclopropyl-N'-methyl-2,9-diazaspiro[4.5]decane-2-carboximidamide.
Molecular Properties
| Compound Name | 9-benzyl-N-cyclopropyl-N'-methyl-2,9-diazaspiro[4.5]decane-2-carboximidamide |
| PubChem CID | 119143302 |
| Molecular Formula | C20H30N4 |
| Molecular Weight | 326.49 g/mol |
| Exact Mass | 326.25 |
| IUPAC Name | 9-benzyl-N-cyclopropyl-N'-methyl-2,9-diazaspiro[4.5]decane-2-carboximidamide |
| SMILES | C/N=C(\NC1CC1)N1CCC2(CCCN(Cc3ccccc3)C2)C1 |
| InChI | InChI=1S/C20H30N4/c1-21-19(22-18-8-9-18)24-13-11-20(16-24)10-5-12-23(15-20)14-17-6-3-2-4-7-17/h2-4,6-7,18H,5,8-16H2,1H3,(H,21,22) |
| InChIKey | RUUMAWFNQOHFRO-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.49 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 9-benzyl-N-cyclopropyl-N'-methyl-2,9-diazaspiro[4.5]decane-2-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-benzyl-N-cyclopropyl-N'-methyl-2,9-diazaspiro[4.5]decane-2-carboximidamide?
The IUPAC name of 9-benzyl-N-cyclopropyl-N'-methyl-2,9-diazaspiro[4.5]decane-2-carboximidamide (CID 119143302) is 9-benzyl-N-cyclopropyl-N'-methyl-2,9-diazaspiro[4.5]decane-2-carboximidamide.
What is the SMILES notation for 9-benzyl-N-cyclopropyl-N'-methyl-2,9-diazaspiro[4.5]decane-2-carboximidamide?
The canonical SMILES for 9-benzyl-N-cyclopropyl-N'-methyl-2,9-diazaspiro[4.5]decane-2-carboximidamide is C/N=C(\NC1CC1)N1CCC2(CCCN(Cc3ccccc3)C2)C1.
What is the InChIKey of 9-benzyl-N-cyclopropyl-N'-methyl-2,9-diazaspiro[4.5]decane-2-carboximidamide?
The InChIKey is RUUMAWFNQOHFRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H30N4/c1-21-19(22-18-8-9-18)24-13-11-20(16-24)10-5-12-23(15-20)14-17-6-3-2-4-7-17/h2-4,6-7,18H,5,8-16H2,1H3,(H,21,22).
What are the key properties of 9-benzyl-N-cyclopropyl-N'-methyl-2,9-diazaspiro[4.5]decane-2-carboximidamide?
9-benzyl-N-cyclopropyl-N'-methyl-2,9-diazaspiro[4.5]decane-2-carboximidamide has a molecular weight of 326.49 g/mol, XLogP of 2.71, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-benzyl-N-cyclopropyl-N'-methyl-2,9-diazaspiro[4.5]decane-2-carboximidamide is sourced from PubChem (CID 119143302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).