C16H24N4OS — CID 119144000
N'-methyl-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide (PubChem CID 119144000) has the molecular formula C16H24N4OS and a molecular weight of 320.46 g/mol. Its IUPAC name is N'-methyl-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide.
| Compound Name | N'-methyl-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide |
|---|---|
| PubChem CID | 119144000 |
| Molecular Formula | C16H24N4OS |
| Molecular Weight | 320.46 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | N'-methyl-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide |
| SMILES | C/N=C(\NCCc1csc(C)n1)N1CC2C3CCC(O3)C2C1 |
| InChI | InChI=1S/C16H24N4OS/c1-10-19-11(9-22-10)5-6-18-16(17-2)20-7-12-13(8-20)15-4-3-14(12)21-15/h9,12-15H,3-8H2,1-2H3,(H,17,18) |
| InChIKey | DTVVCUGGQMXGAL-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 49.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.46 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|