About N'-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)morpholine-4-carboximidamide
N'-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)morpholine-4-carboximidamide (PubChem CID 119148239) has the molecular formula C14H25N3O2
and a molecular weight of 267.37 g/mol. Its IUPAC name is N'-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)morpholine-4-carboximidamide.
Molecular Properties
| Compound Name | N'-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)morpholine-4-carboximidamide |
| PubChem CID | 119148239 |
| Molecular Formula | C14H25N3O2 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.19 |
| IUPAC Name | N'-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)morpholine-4-carboximidamide |
| SMILES | CC1(C)C(/N=C(\N)N2CCOCC2)C2CCCOC21 |
| InChI | InChI=1S/C14H25N3O2/c1-14(2)11(10-4-3-7-19-12(10)14)16-13(15)17-5-8-18-9-6-17/h10-12H,3-9H2,1-2H3,(H2,15,16) |
| InChIKey | VOGAODBKJIHEHQ-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 60.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)morpholine-4-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)morpholine-4-carboximidamide?
The IUPAC name of N'-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)morpholine-4-carboximidamide (CID 119148239) is N'-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)morpholine-4-carboximidamide.
What is the SMILES notation for N'-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)morpholine-4-carboximidamide?
The canonical SMILES for N'-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)morpholine-4-carboximidamide is CC1(C)C(/N=C(\N)N2CCOCC2)C2CCCOC21.
What is the InChIKey of N'-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)morpholine-4-carboximidamide?
The InChIKey is VOGAODBKJIHEHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25N3O2/c1-14(2)11(10-4-3-7-19-12(10)14)16-13(15)17-5-8-18-9-6-17/h10-12H,3-9H2,1-2H3,(H2,15,16).
What are the key properties of N'-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)morpholine-4-carboximidamide?
N'-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)morpholine-4-carboximidamide has a molecular weight of 267.37 g/mol, XLogP of 0.84, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)morpholine-4-carboximidamide is sourced from PubChem (CID 119148239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).