C12H20F3IN4 — CID 119149137
2-methyl-1-prop-2-ynyl-3-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]guanidine;hydroiodide (PubChem CID 119149137) has the molecular formula C12H20F3IN4 and a molecular weight of 404.22 g/mol. Its IUPAC name is 2-methyl-1-prop-2-ynyl-3-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-prop-2-ynyl-3-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 119149137 |
| Molecular Formula | C12H20F3IN4 |
| Molecular Weight | 404.22 g/mol |
| Exact Mass | 404.07 |
| IUPAC Name | 2-methyl-1-prop-2-ynyl-3-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]guanidine;hydroiodide |
| SMILES | C#CCN/C(=N\C)NCC1CCN(CC(F)(F)F)C1.I |
| InChI | InChI=1S/C12H19F3N4.HI/c1-3-5-17-11(16-2)18-7-10-4-6-19(8-10)9-12(13,14)15;/h1,10H,4-9H2,2H3,(H2,16,17,18);1H |
| InChIKey | XIEQBJSABPKLES-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.22 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|