C17H33N3O2 — CID 119149324
2-[methyl-[2-[1-(1-methylpiperidin-4-yl)piperidin-4-yl]ethyl]amino]propanoic acid (PubChem CID 119149324) has the molecular formula C17H33N3O2 and a molecular weight of 311.47 g/mol. Its IUPAC name is 2-[methyl-[2-[1-(1-methylpiperidin-4-yl)piperidin-4-yl]ethyl]amino]propanoic acid.
| Compound Name | 2-[methyl-[2-[1-(1-methylpiperidin-4-yl)piperidin-4-yl]ethyl]amino]propanoic acid |
|---|---|
| PubChem CID | 119149324 |
| Molecular Formula | C17H33N3O2 |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.26 |
| IUPAC Name | 2-[methyl-[2-[1-(1-methylpiperidin-4-yl)piperidin-4-yl]ethyl]amino]propanoic acid |
| SMILES | CC(C(=O)O)N(C)CCC1CCN(C2CCN(C)CC2)CC1 |
| InChI | InChI=1S/C17H33N3O2/c1-14(17(21)22)19(3)11-4-15-5-12-20(13-6-15)16-7-9-18(2)10-8-16/h14-16H,4-13H2,1-3H3,(H,21,22) |
| InChIKey | RXRZZWJPWMINDX-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 47.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |