C30H46N2 — CID 11914978
2-[(5S,8S,9R,10S,13R,14S,17S)-10,13-dimethyl-17-[(2S)-6-methylheptan-2-yl]-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ylidene]propanedinitrile (PubChem CID 11914978) has the molecular formula C30H46N2 and a molecular weight of 434.71 g/mol. Its IUPAC name is 2-[(5S,8S,9R,10S,13R,14S,17S)-10,13-dimethyl-17-[(2S)-6-methylheptan-2-yl]-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ylidene]propanedinitrile.
| Compound Name | 2-[(5S,8S,9R,10S,13R,14S,17S)-10,13-dimethyl-17-[(2S)-6-methylheptan-2-yl]-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 11914978 |
| Molecular Formula | C30H46N2 |
| Molecular Weight | 434.71 g/mol |
| Exact Mass | 434.37 |
| IUPAC Name | 2-[(5S,8S,9R,10S,13R,14S,17S)-10,13-dimethyl-17-[(2S)-6-methylheptan-2-yl]-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ylidene]propanedinitrile |
| SMILES | CC(C)CCC[C@H](C)[C@@H]1CC[C@H]2[C@H]3CC[C@H]4CC(=C(C#N)C#N)CC[C@]4(C)[C@@H]3CC[C@@]21C |
| InChI | InChI=1S/C30H46N2/c1-20(2)7-6-8-21(3)26-11-12-27-25-10-9-24-17-22(23(18-31)19-32)13-15-29(24,4)28(25)14-16-30(26,27)5/h20-21,24-28H,6-17H2,1-5H3/t21-,24-,25+,26-,27-,28+,29-,30+/m0/s1 |
| InChIKey | JSHDHNOUIHXVMP-RQJPCNMBSA-N |
| XLogP | 8.45 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.71 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|