C19H25FN4OS — CID 11915151
(2R)-N-[(1R,2R,3S)-2,3-dimethylcyclohexyl]-2-[[5-(2-fluorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]propanamide (PubChem CID 11915151) has the molecular formula C19H25FN4OS and a molecular weight of 376.50 g/mol. Its IUPAC name is (2R)-N-[(1R,2R,3S)-2,3-dimethylcyclohexyl]-2-[[5-(2-fluorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]propanamide.
| Compound Name | (2R)-N-[(1R,2R,3S)-2,3-dimethylcyclohexyl]-2-[[5-(2-fluorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]propanamide |
|---|---|
| PubChem CID | 11915151 |
| Molecular Formula | C19H25FN4OS |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | (2R)-N-[(1R,2R,3S)-2,3-dimethylcyclohexyl]-2-[[5-(2-fluorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]propanamide |
| SMILES | C[C@@H]1[C@@H](C)CCC[C@H]1NC(=O)[C@@H](C)Sc1n[nH]c(-c2ccccc2F)n1 |
| InChI | InChI=1S/C19H25FN4OS/c1-11-7-6-10-16(12(11)2)21-18(25)13(3)26-19-22-17(23-24-19)14-8-4-5-9-15(14)20/h4-5,8-9,11-13,16H,6-7,10H2,1-3H3,(H,21,25)(H,22,23,24)/t11-,12+,13+,16+/m0/s1 |
| InChIKey | RTTGEXNMQQVBMO-VPWBDBDCSA-N |
| XLogP | 4.03 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |