About 4-pyrimidin-2-yl-N'-[[3-(trifluoromethyl)cyclohexyl]methyl]piperazine-1-carboximidamide
4-pyrimidin-2-yl-N'-[[3-(trifluoromethyl)cyclohexyl]methyl]piperazine-1-carboximidamide (PubChem CID 119152066) has the molecular formula C17H25F3N6
and a molecular weight of 370.42 g/mol. Its IUPAC name is 4-pyrimidin-2-yl-N'-[[3-(trifluoromethyl)cyclohexyl]methyl]piperazine-1-carboximidamide.
Molecular Properties
| Compound Name | 4-pyrimidin-2-yl-N'-[[3-(trifluoromethyl)cyclohexyl]methyl]piperazine-1-carboximidamide |
| PubChem CID | 119152066 |
| Molecular Formula | C17H25F3N6 |
| Molecular Weight | 370.42 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | 4-pyrimidin-2-yl-N'-[[3-(trifluoromethyl)cyclohexyl]methyl]piperazine-1-carboximidamide |
| SMILES | N/C(=N\CC1CCCC(C(F)(F)F)C1)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C17H25F3N6/c18-17(19,20)14-4-1-3-13(11-14)12-24-15(21)25-7-9-26(10-8-25)16-22-5-2-6-23-16/h2,5-6,13-14H,1,3-4,7-12H2,(H2,21,24) |
| InChIKey | XZGUMQRBIREPDS-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.42 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 4-pyrimidin-2-yl-N'-[[3-(trifluoromethyl)cyclohexyl]methyl]piperazine-1-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-pyrimidin-2-yl-N'-[[3-(trifluoromethyl)cyclohexyl]methyl]piperazine-1-carboximidamide?
The IUPAC name of 4-pyrimidin-2-yl-N'-[[3-(trifluoromethyl)cyclohexyl]methyl]piperazine-1-carboximidamide (CID 119152066) is 4-pyrimidin-2-yl-N'-[[3-(trifluoromethyl)cyclohexyl]methyl]piperazine-1-carboximidamide.
What is the SMILES notation for 4-pyrimidin-2-yl-N'-[[3-(trifluoromethyl)cyclohexyl]methyl]piperazine-1-carboximidamide?
The canonical SMILES for 4-pyrimidin-2-yl-N'-[[3-(trifluoromethyl)cyclohexyl]methyl]piperazine-1-carboximidamide is N/C(=N\CC1CCCC(C(F)(F)F)C1)N1CCN(c2ncccn2)CC1.
What is the InChIKey of 4-pyrimidin-2-yl-N'-[[3-(trifluoromethyl)cyclohexyl]methyl]piperazine-1-carboximidamide?
The InChIKey is XZGUMQRBIREPDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25F3N6/c18-17(19,20)14-4-1-3-13(11-14)12-24-15(21)25-7-9-26(10-8-25)16-22-5-2-6-23-16/h2,5-6,13-14H,1,3-4,7-12H2,(H2,21,24).
What are the key properties of 4-pyrimidin-2-yl-N'-[[3-(trifluoromethyl)cyclohexyl]methyl]piperazine-1-carboximidamide?
4-pyrimidin-2-yl-N'-[[3-(trifluoromethyl)cyclohexyl]methyl]piperazine-1-carboximidamide has a molecular weight of 370.42 g/mol, XLogP of 2.28, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-pyrimidin-2-yl-N'-[[3-(trifluoromethyl)cyclohexyl]methyl]piperazine-1-carboximidamide is sourced from PubChem (CID 119152066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).